C24H23N7O3S2 — CID 42769726
[2-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 42769726) has the molecular formula C24H23N7O3S2 and a molecular weight of 521.63 g/mol. Its IUPAC name is [2-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42769726 |
| Molecular Formula | C24H23N7O3S2 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | [2-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1nnc(SCc2nc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cs2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H23N7O3S2/c1-17-26-27-24(30(17)19-5-3-2-4-6-19)36-16-22-25-21(15-35-22)23(32)29-13-11-28(12-14-29)18-7-9-20(10-8-18)31(33)34/h2-10,15H,11-14,16H2,1H3 |
| InChIKey | QRPKLRHPALLHPB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|