C30H26ClN7O3S2 — CID 3611680
[2-[[5-benzyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 3611680) has the molecular formula C30H26ClN7O3S2 and a molecular weight of 632.17 g/mol. Its IUPAC name is [2-[[5-benzyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-[[5-benzyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3611680 |
| Molecular Formula | C30H26ClN7O3S2 |
| Molecular Weight | 632.17 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | [2-[[5-benzyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1csc(CSc2nnc(Cc3ccccc3)n2-c2cccc(Cl)c2)n1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C30H26ClN7O3S2/c31-22-7-4-8-25(18-22)37-27(17-21-5-2-1-3-6-21)33-34-30(37)43-20-28-32-26(19-42-28)29(39)36-15-13-35(14-16-36)23-9-11-24(12-10-23)38(40)41/h1-12,18-19H,13-17,20H2 |
| InChIKey | GGEJIULZSPUDEL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.17 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|