C31H26F3N7O3S2 — CID 3981229
[2-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 3981229) has the molecular formula C31H26F3N7O3S2 and a molecular weight of 665.72 g/mol. Its IUPAC name is [2-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3981229 |
| Molecular Formula | C31H26F3N7O3S2 |
| Molecular Weight | 665.72 g/mol |
| Exact Mass | 665.15 |
| IUPAC Name | [2-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1csc(CSc2nnc(Cc3ccccc3)n2-c2cccc(C(F)(F)F)c2)n1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C31H26F3N7O3S2/c32-31(33,34)22-7-4-8-25(18-22)40-27(17-21-5-2-1-3-6-21)36-37-30(40)46-20-28-35-26(19-45-28)29(42)39-15-13-38(14-16-39)23-9-11-24(12-10-23)41(43)44/h1-12,18-19H,13-17,20H2 |
| InChIKey | NBBAPFQZFDQVLY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|