C28H24ClN7O4S2 — CID 3486402
[2-[[4-(5-chloro-2-methylphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 3486402) has the molecular formula C28H24ClN7O4S2 and a molecular weight of 622.13 g/mol. Its IUPAC name is [2-[[4-(5-chloro-2-methylphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-[[4-(5-chloro-2-methylphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3486402 |
| Molecular Formula | C28H24ClN7O4S2 |
| Molecular Weight | 622.13 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | [2-[[4-(5-chloro-2-methylphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-4-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(Cl)cc1-n1c(SCc2nc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cs2)nnc1-c1ccco1 |
| InChI | InChI=1S/C28H24ClN7O4S2/c1-18-4-5-19(29)15-23(18)35-26(24-3-2-14-40-24)31-32-28(35)42-17-25-30-22(16-41-25)27(37)34-12-10-33(11-13-34)20-6-8-21(9-7-20)36(38)39/h2-9,14-16H,10-13,17H2,1H3 |
| InChIKey | DGWJPGLINYKBIO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.13 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|