C20H21BrFNO3 — CID 38929220
(2S)-2-(2-bromo-4-fluorophenoxy)-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 38929220) has the molecular formula C20H21BrFNO3 and a molecular weight of 422.29 g/mol. Its IUPAC name is (2S)-2-(2-bromo-4-fluorophenoxy)-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | (2S)-2-(2-bromo-4-fluorophenoxy)-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 38929220 |
| Molecular Formula | C20H21BrFNO3 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (2S)-2-(2-bromo-4-fluorophenoxy)-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CN(C(=O)[C@H](C)Oc2ccc(F)cc2Br)C2CC2)cc1 |
| InChI | InChI=1S/C20H21BrFNO3/c1-13(26-19-10-5-15(22)11-18(19)21)20(24)23(16-6-7-16)12-14-3-8-17(25-2)9-4-14/h3-5,8-11,13,16H,6-7,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | GNAVNEDMFKZMAU-ZDUSSCGKSA-N |
| XLogP | 4.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |