C23H14N4O4 — CID 38934566
N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)acetamide (PubChem CID 38934566) has the molecular formula C23H14N4O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)acetamide |
|---|---|
| PubChem CID | 38934566 |
| Molecular Formula | C23H14N4O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-1,2,3-benzotriazin-3-yl)acetamide |
| SMILES | O=C(Cn1nnc2ccccc2c1=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H14N4O4/c28-20(12-27-23(31)17-7-3-4-8-19(17)25-26-27)24-13-9-10-16-18(11-13)22(30)15-6-2-1-5-14(15)21(16)29/h1-11H,12H2,(H,24,28) |
| InChIKey | QSSWGZMHNKPZOK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|