C16H16FN3O3S — CID 3894684
prop-2-enyl N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3894684) has the molecular formula C16H16FN3O3S and a molecular weight of 349.39 g/mol. Its IUPAC name is prop-2-enyl N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | prop-2-enyl N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3894684 |
| Molecular Formula | C16H16FN3O3S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | prop-2-enyl N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | C=CCS/C(=N\c1ccc(F)cc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H16FN3O3S/c1-4-9-24-13(18-11-7-5-10(17)6-8-11)12-14(21)19(2)16(23)20(3)15(12)22/h4-8,21H,1,9H2,2-3H3/b18-13- |
| InChIKey | OIGXJEKJGQMIPB-AQTBWJFISA-N |
| XLogP | 1.93 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|