C23H23FN2O5S2 — CID 38958841
N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(3-phenylpropylsulfonyl)acetamide (PubChem CID 38958841) has the molecular formula C23H23FN2O5S2 and a molecular weight of 490.58 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(3-phenylpropylsulfonyl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(3-phenylpropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 38958841 |
| Molecular Formula | C23H23FN2O5S2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(3-phenylpropylsulfonyl)acetamide |
| SMILES | O=C(CS(=O)(=O)CCCc1ccccc1)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C23H23FN2O5S2/c24-19-11-5-4-10-18(19)15-20-22(28)26(23(29)32-20)13-12-25-21(27)16-33(30,31)14-6-9-17-7-2-1-3-8-17/h1-5,7-8,10-11,15H,6,9,12-14,16H2,(H,25,27)/b20-15- |
| InChIKey | VHSVTXSFNJMDML-HKWRFOASSA-N |
| XLogP | 3.03 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|