C17H15ClN6O5S — CID 3896473
N-[[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]furan-2-carboxamide (PubChem CID 3896473) has the molecular formula C17H15ClN6O5S and a molecular weight of 450.86 g/mol. Its IUPAC name is N-[[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3896473 |
| Molecular Formula | C17H15ClN6O5S |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-[[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]furan-2-carboxamide |
| SMILES | Cn1c(CNC(=O)c2ccco2)nnc1SCC(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H15ClN6O5S/c1-23-14(8-19-16(26)13-3-2-6-29-13)21-22-17(23)30-9-15(25)20-12-7-10(24(27)28)4-5-11(12)18/h2-7H,8-9H2,1H3,(H,19,26)(H,20,25) |
| InChIKey | KZGWBGKYGBXVPK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|