C19H14ClN3OS — CID 38973161
3-[(6-chloro-3-pyridinyl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 38973161) has the molecular formula C19H14ClN3OS and a molecular weight of 367.86 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 38973161 |
| Molecular Formula | C19H14ClN3OS |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1c(-c2ccccc2)sc2ncn(Cc3ccc(Cl)nc3)c(=O)c12 |
| InChI | InChI=1S/C19H14ClN3OS/c1-12-16-18(25-17(12)14-5-3-2-4-6-14)22-11-23(19(16)24)10-13-7-8-15(20)21-9-13/h2-9,11H,10H2,1H3 |
| InChIKey | APAFUUCUMAKBLU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|