C30H25Cl2NO3 — CID 38989695
benzyl (4R,7S)-4-(2,4-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 38989695) has the molecular formula C30H25Cl2NO3 and a molecular weight of 518.44 g/mol. Its IUPAC name is benzyl (4R,7S)-4-(2,4-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | benzyl (4R,7S)-4-(2,4-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 38989695 |
| Molecular Formula | C30H25Cl2NO3 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | benzyl (4R,7S)-4-(2,4-dichlorophenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)[C@H](c2ccc(Cl)cc2Cl)C2=C(C[C@H](c3ccccc3)CC2=O)N1 |
| InChI | InChI=1S/C30H25Cl2NO3/c1-18-27(30(35)36-17-19-8-4-2-5-9-19)28(23-13-12-22(31)16-24(23)32)29-25(33-18)14-21(15-26(29)34)20-10-6-3-7-11-20/h2-13,16,21,28,33H,14-15,17H2,1H3/t21-,28-/m0/s1 |
| InChIKey | QCQXLAVSGJTQPS-KMRXNPHXSA-N |
| XLogP | 7.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |