C30H34ClN3O3 — CID 3899156
[2-(dicyclohexylamino)-2-oxoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 3899156) has the molecular formula C30H34ClN3O3 and a molecular weight of 520.07 g/mol. Its IUPAC name is [2-(dicyclohexylamino)-2-oxoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-(dicyclohexylamino)-2-oxoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 3899156 |
| Molecular Formula | C30H34ClN3O3 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | [2-(dicyclohexylamino)-2-oxoethyl] 3-(4-chlorophenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | O=C(OCC(=O)N(C1CCCCC1)C1CCCCC1)c1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H34ClN3O3/c31-23-18-16-22(17-19-23)29-27(20-33(32-29)24-10-4-1-5-11-24)30(36)37-21-28(35)34(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1,4-5,10-11,16-20,25-26H,2-3,6-9,12-15,21H2 |
| InChIKey | ZMMLKICHOUUHAI-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |