C24H32F3N3O4 — CID 3900291
4-hydroxy-4,7,7,9,9-pentamethyl-3-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 3900291) has the molecular formula C24H32F3N3O4 and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-hydroxy-4,7,7,9,9-pentamethyl-3-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 4-hydroxy-4,7,7,9,9-pentamethyl-3-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 3900291 |
| Molecular Formula | C24H32F3N3O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-hydroxy-4,7,7,9,9-pentamethyl-3-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | Cc1[nH]c2ccc(OC(F)(F)F)cc2c1CCN1C(=O)OC2(CC(C)(C)NC(C)(C)C2)C1(C)O |
| InChI | InChI=1S/C24H32F3N3O4/c1-14-16(17-11-15(33-24(25,26)27)7-8-18(17)28-14)9-10-30-19(31)34-23(22(30,6)32)12-20(2,3)29-21(4,5)13-23/h7-8,11,28-29,32H,9-10,12-13H2,1-6H3 |
| InChIKey | UDRJPFOVXLSABQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|