C28H26N4O — CID 39036597
[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-(2-pyridin-2-ylquinolin-4-yl)methanone (PubChem CID 39036597) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is [4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-(2-pyridin-2-ylquinolin-4-yl)methanone.
| Compound Name | [4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-(2-pyridin-2-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 39036597 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-(2-pyridin-2-ylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccn2)nc2ccccc12)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C28H26N4O/c33-28(32-19-17-31(18-20-32)16-8-11-22-9-2-1-3-10-22)24-21-27(26-14-6-7-15-29-26)30-25-13-5-4-12-23(24)25/h1-15,21H,16-20H2/b11-8+ |
| InChIKey | HFYVQXXXLDMFAM-DHZHZOJOSA-N |
| XLogP | 4.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |