C30H29N3O — CID 42749683
(6-methyl-2-phenylquinolin-4-yl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone (PubChem CID 42749683) has the molecular formula C30H29N3O and a molecular weight of 447.58 g/mol. Its IUPAC name is (6-methyl-2-phenylquinolin-4-yl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone.
| Compound Name | (6-methyl-2-phenylquinolin-4-yl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42749683 |
| Molecular Formula | C30H29N3O |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (6-methyl-2-phenylquinolin-4-yl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc2nc(-c3ccccc3)cc(C(=O)N3CCN(C/C=C/c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C30H29N3O/c1-23-14-15-28-26(21-23)27(22-29(31-28)25-12-6-3-7-13-25)30(34)33-19-17-32(18-20-33)16-8-11-24-9-4-2-5-10-24/h2-15,21-22H,16-20H2,1H3/b11-8+ |
| InChIKey | JXHLEDSOIVDFEW-DHZHZOJOSA-N |
| XLogP | 5.68 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |