C22H22BrN3O — CID 2220574
[2-(3-bromophenyl)-6-methylquinolin-4-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 2220574) has the molecular formula C22H22BrN3O and a molecular weight of 424.34 g/mol. Its IUPAC name is [2-(3-bromophenyl)-6-methylquinolin-4-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [2-(3-bromophenyl)-6-methylquinolin-4-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 2220574 |
| Molecular Formula | C22H22BrN3O |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [2-(3-bromophenyl)-6-methylquinolin-4-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc2nc(-c3cccc(Br)c3)cc(C(=O)N3CCN(C)CC3)c2c1 |
| InChI | InChI=1S/C22H22BrN3O/c1-15-6-7-20-18(12-15)19(22(27)26-10-8-25(2)9-11-26)14-21(24-20)16-4-3-5-17(23)13-16/h3-7,12-14H,8-11H2,1-2H3 |
| InChIKey | AGBVVQLGWCECMZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |