C22H23BrN3O+ — CID 2220573
[2-(3-bromophenyl)-6-methylquinolin-4-yl]-(4-methylpiperazin-4-ium-1-yl)methanone (PubChem CID 2220573) has the molecular formula C22H23BrN3O+ and a molecular weight of 425.35 g/mol. Its IUPAC name is [2-(3-bromophenyl)-6-methylquinolin-4-yl]-(4-methylpiperazin-4-ium-1-yl)methanone.
| Compound Name | [2-(3-bromophenyl)-6-methylquinolin-4-yl]-(4-methylpiperazin-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 2220573 |
| Molecular Formula | C22H23BrN3O+ |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [2-(3-bromophenyl)-6-methylquinolin-4-yl]-(4-methylpiperazin-4-ium-1-yl)methanone |
| SMILES | Cc1ccc2nc(-c3cccc(Br)c3)cc(C(=O)N3CC[NH+](C)CC3)c2c1 |
| InChI | InChI=1S/C22H22BrN3O/c1-15-6-7-20-18(12-15)19(22(27)26-10-8-25(2)9-11-26)14-21(24-20)16-4-3-5-17(23)13-16/h3-7,12-14H,8-11H2,1-2H3/p+1 |
| InChIKey | AGBVVQLGWCECMZ-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |