C24H26BrN3O — CID 17126607
(6-bromo-2-phenylquinolin-4-yl)-(4-butylpiperazin-1-yl)methanone (PubChem CID 17126607) has the molecular formula C24H26BrN3O and a molecular weight of 452.40 g/mol. Its IUPAC name is (6-bromo-2-phenylquinolin-4-yl)-(4-butylpiperazin-1-yl)methanone.
| Compound Name | (6-bromo-2-phenylquinolin-4-yl)-(4-butylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 17126607 |
| Molecular Formula | C24H26BrN3O |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (6-bromo-2-phenylquinolin-4-yl)-(4-butylpiperazin-1-yl)methanone |
| SMILES | CCCCN1CCN(C(=O)c2cc(-c3ccccc3)nc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C24H26BrN3O/c1-2-3-11-27-12-14-28(15-13-27)24(29)21-17-23(18-7-5-4-6-8-18)26-22-10-9-19(25)16-20(21)22/h4-10,16-17H,2-3,11-15H2,1H3 |
| InChIKey | AKCQQRURMMFUBE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |