C18H15N5O5S — CID 3903857
N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-carboxamide (PubChem CID 3903857) has the molecular formula C18H15N5O5S and a molecular weight of 413.42 g/mol. Its IUPAC name is N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-carboxamide.
| Compound Name | N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 3903857 |
| Molecular Formula | C18H15N5O5S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(O)c([N+](=O)[O-])c1)c1nc2sc3c(c2c(=O)[nH]1)CCCC3 |
| InChI | InChI=1S/C18H15N5O5S/c24-12-6-5-9(7-11(12)23(27)28)8-19-22-17(26)15-20-16(25)14-10-3-1-2-4-13(10)29-18(14)21-15/h5-8,24H,1-4H2,(H,22,26)(H,20,21,25) |
| InChIKey | DSAXTEIMUKJTES-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|