C19H20N4O3 — CID 39045222
(3S)-5-oxo-N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]-1-phenylpyrrolidine-3-carboxamide (PubChem CID 39045222) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is (3S)-5-oxo-N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-5-oxo-N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 39045222 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (3S)-5-oxo-N-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]-1-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(CNC(=O)[C@H]1CC(=O)N(c2ccccc2)C1)NCc1ccncc1 |
| InChI | InChI=1S/C19H20N4O3/c24-17(21-11-14-6-8-20-9-7-14)12-22-19(26)15-10-18(25)23(13-15)16-4-2-1-3-5-16/h1-9,15H,10-13H2,(H,21,24)(H,22,26)/t15-/m0/s1 |
| InChIKey | LCGQHCHEFGKMDX-HNNXBMFYSA-N |
| XLogP | 0.87 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |