C21H23N3O3S — CID 39045520
methyl 2-(7-cyclohexyl-12-oxo-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-13-yl)acetate (PubChem CID 39045520) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is methyl 2-(7-cyclohexyl-12-oxo-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-13-yl)acetate.
| Compound Name | methyl 2-(7-cyclohexyl-12-oxo-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-13-yl)acetate |
|---|---|
| PubChem CID | 39045520 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl 2-(7-cyclohexyl-12-oxo-10-thia-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-13-yl)acetate |
| SMILES | COC(=O)Cn1cnc2c(sc3nc(C4CCCCC4)c4c(c32)CCC4)c1=O |
| InChI | InChI=1S/C21H23N3O3S/c1-27-15(25)10-24-11-22-18-16-13-8-5-9-14(13)17(12-6-3-2-4-7-12)23-20(16)28-19(18)21(24)26/h11-12H,2-10H2,1H3 |
| InChIKey | FWHAQHPNABRTOM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |