C20H22N4O3 — CID 39352511
2-(7-cyclohexyl-12-oxo-10-oxa-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-13-yl)acetamide (PubChem CID 39352511) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(7-cyclohexyl-12-oxo-10-oxa-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-13-yl)acetamide.
| Compound Name | 2-(7-cyclohexyl-12-oxo-10-oxa-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-13-yl)acetamide |
|---|---|
| PubChem CID | 39352511 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(7-cyclohexyl-12-oxo-10-oxa-8,13,15-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-13-yl)acetamide |
| SMILES | NC(=O)Cn1cnc2c(oc3nc(C4CCCCC4)c4c(c32)CCC4)c1=O |
| InChI | InChI=1S/C20H22N4O3/c21-14(25)9-24-10-22-17-15-12-7-4-8-13(12)16(11-5-2-1-3-6-11)23-19(15)27-18(17)20(24)26/h10-11H,1-9H2,(H2,21,25) |
| InChIKey | LUMZYXRQOZIVKR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |