C17H14O5S — CID 3905144
2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]sulfanylbenzoic acid (PubChem CID 3905144) has the molecular formula C17H14O5S and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]sulfanylbenzoic acid.
| Compound Name | 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 3905144 |
| Molecular Formula | C17H14O5S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]sulfanylbenzoic acid |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)Sc1ccccc1C(=O)O |
| InChI | InChI=1S/C17H14O5S/c18-16(23-15-4-2-1-3-12(15)17(19)20)10-11-5-6-13-14(9-11)22-8-7-21-13/h1-6,9H,7-8,10H2,(H,19,20) |
| InChIKey | ZSGVATMATIZLGX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|