C17H17N5O — CID 3906266
7-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 3906266) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 7-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 3906266 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 7-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccnc2nc(C(=O)NC3CCCc4ccccc43)nn12 |
| InChI | InChI=1S/C17H17N5O/c1-11-9-10-18-17-20-15(21-22(11)17)16(23)19-14-8-4-6-12-5-2-3-7-13(12)14/h2-3,5,7,9-10,14H,4,6,8H2,1H3,(H,19,23) |
| InChIKey | GYMKDBPAFLRVNR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |