C16H19N3O3 — CID 3907096
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(3,4-dimethylphenyl)propan-1-one (PubChem CID 3907096) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(3,4-dimethylphenyl)propan-1-one.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(3,4-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 3907096 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-(3,4-dimethylphenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)C(C)n2nc(C)c([N+](=O)[O-])c2C)cc1C |
| InChI | InChI=1S/C16H19N3O3/c1-9-6-7-14(8-10(9)2)16(20)13(5)18-12(4)15(19(21)22)11(3)17-18/h6-8,13H,1-5H3 |
| InChIKey | YZOHQTKMEWMIJB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|