C17H20N6S — CID 39076369
5-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-amine (PubChem CID 39076369) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is 5-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 39076369 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-[[4-(3,5-dimethylpyrazol-1-yl)phenyl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-amine |
| SMILES | C=CCn1c(N)nnc1SCc1ccc(-n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C17H20N6S/c1-4-9-22-16(18)19-20-17(22)24-11-14-5-7-15(8-6-14)23-13(3)10-12(2)21-23/h4-8,10H,1,9,11H2,2-3H3,(H2,18,19) |
| InChIKey | TWVCHQFPOVGOKP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|