C19H24ClN3OS — CID 39084197
2-(4-chlorophenyl)-4-methyl-N-(4-pyrrolidin-1-ylbutyl)-1,3-thiazole-5-carboxamide (PubChem CID 39084197) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-methyl-N-(4-pyrrolidin-1-ylbutyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-4-methyl-N-(4-pyrrolidin-1-ylbutyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39084197 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-(4-chlorophenyl)-4-methyl-N-(4-pyrrolidin-1-ylbutyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)NCCCCN1CCCC1 |
| InChI | InChI=1S/C19H24ClN3OS/c1-14-17(25-19(22-14)15-6-8-16(20)9-7-15)18(24)21-10-2-3-11-23-12-4-5-13-23/h6-9H,2-5,10-13H2,1H3,(H,21,24) |
| InChIKey | NBPHPEAJOCETJY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|