C20H24F3N3OS — CID 59338656
4-methyl-N-(4-pyrrolidin-1-ylbutyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 59338656) has the molecular formula C20H24F3N3OS and a molecular weight of 411.49 g/mol. Its IUPAC name is 4-methyl-N-(4-pyrrolidin-1-ylbutyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(4-pyrrolidin-1-ylbutyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59338656 |
| Molecular Formula | C20H24F3N3OS |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-methyl-N-(4-pyrrolidin-1-ylbutyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccc(C(F)(F)F)c2)sc1C(=O)NCCCCN1CCCC1 |
| InChI | InChI=1S/C20H24F3N3OS/c1-14-17(18(27)24-9-2-3-10-26-11-4-5-12-26)28-19(25-14)15-7-6-8-16(13-15)20(21,22)23/h6-8,13H,2-5,9-12H2,1H3,(H,24,27) |
| InChIKey | ZMUGTQAUAYMPJN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|