C17H21N3OS3 — CID 59337853
2-[3-(disulfanyl)phenyl]-4-methyl-N-(2-pyrrolidin-1-ylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 59337853) has the molecular formula C17H21N3OS3 and a molecular weight of 379.58 g/mol. Its IUPAC name is 2-[3-(disulfanyl)phenyl]-4-methyl-N-(2-pyrrolidin-1-ylethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3-(disulfanyl)phenyl]-4-methyl-N-(2-pyrrolidin-1-ylethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59337853 |
| Molecular Formula | C17H21N3OS3 |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-[3-(disulfanyl)phenyl]-4-methyl-N-(2-pyrrolidin-1-ylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccc(SS)c2)sc1C(=O)NCCN1CCCC1 |
| InChI | InChI=1S/C17H21N3OS3/c1-12-15(16(21)18-7-10-20-8-2-3-9-20)23-17(19-12)13-5-4-6-14(11-13)24-22/h4-6,11,22H,2-3,7-10H2,1H3,(H,18,21) |
| InChIKey | HMYHLQRILOTBFU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|