C18H19N5O2S — CID 39085150
N-(2-acetamidoethyl)-2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]acetamide (PubChem CID 39085150) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 39085150 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]acetamide |
| SMILES | CC(=O)NCCNC(=O)CNc1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C18H19N5O2S/c1-12(24)19-7-8-20-16(25)10-21-17-14-9-15(13-5-3-2-4-6-13)26-18(14)23-11-22-17/h2-6,9,11H,7-8,10H2,1H3,(H,19,24)(H,20,25)(H,21,22,23) |
| InChIKey | AHSXVBPOTZFHNG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|