C19H15N5OS — CID 133367589
2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-N-pyridin-2-ylacetamide (PubChem CID 133367589) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 133367589 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-N-pyridin-2-ylacetamide |
| SMILES | O=C(CNc1ncnc2sc(-c3ccccc3)cc12)Nc1ccccn1 |
| InChI | InChI=1S/C19H15N5OS/c25-17(24-16-8-4-5-9-20-16)11-21-18-14-10-15(13-6-2-1-3-7-13)26-19(14)23-12-22-18/h1-10,12H,11H2,(H,20,24,25)(H,21,22,23) |
| InChIKey | SRGSRGVRDFUDBI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |