About 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol
2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol (PubChem CID 39098009) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol.
Molecular Properties
| Compound Name | 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol |
| PubChem CID | 39098009 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol |
| SMILES | COc1cc2onc(CCS)c2cc1OC |
| InChI | InChI=1S/C11H13NO3S/c1-13-10-5-7-8(3-4-16)12-15-9(7)6-11(10)14-2/h5-6,16H,3-4H2,1-2H3 |
| InChIKey | VEULACOZWWMQFR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol?
The IUPAC name of 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol (CID 39098009) is 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol.
What is the SMILES notation for 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol?
The canonical SMILES for 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol is COc1cc2onc(CCS)c2cc1OC.
What is the InChIKey of 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol?
The InChIKey is VEULACOZWWMQFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-13-10-5-7-8(3-4-16)12-15-9(7)6-11(10)14-2/h5-6,16H,3-4H2,1-2H3.
What are the key properties of 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol?
2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol has a molecular weight of 239.30 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethoxy-1,2-benzoxazol-3-yl)ethanethiol is sourced from PubChem (CID 39098009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).