C10H9BrClNO — CID 39097570
3-(2-bromoethyl)-5-chloro-6-methyl-1,2-benzoxazole (PubChem CID 39097570) has the molecular formula C10H9BrClNO and a molecular weight of 274.55 g/mol. Its IUPAC name is 3-(2-bromoethyl)-5-chloro-6-methyl-1,2-benzoxazole.
| Compound Name | 3-(2-bromoethyl)-5-chloro-6-methyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 39097570 |
| Molecular Formula | C10H9BrClNO |
| Molecular Weight | 274.55 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 3-(2-bromoethyl)-5-chloro-6-methyl-1,2-benzoxazole |
| SMILES | Cc1cc2onc(CCBr)c2cc1Cl |
| InChI | InChI=1S/C10H9BrClNO/c1-6-4-10-7(5-8(6)12)9(2-3-11)13-14-10/h4-5H,2-3H2,1H3 |
| InChIKey | PICBTKJZTNSVAB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|