C17H16BrNO2 — CID 39097650
3-(2-bromoethyl)-6-(2-phenylethoxy)-1,2-benzoxazole (PubChem CID 39097650) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 3-(2-bromoethyl)-6-(2-phenylethoxy)-1,2-benzoxazole.
| Compound Name | 3-(2-bromoethyl)-6-(2-phenylethoxy)-1,2-benzoxazole |
|---|---|
| PubChem CID | 39097650 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-(2-bromoethyl)-6-(2-phenylethoxy)-1,2-benzoxazole |
| SMILES | BrCCc1noc2cc(OCCc3ccccc3)ccc12 |
| InChI | InChI=1S/C17H16BrNO2/c18-10-8-16-15-7-6-14(12-17(15)21-19-16)20-11-9-13-4-2-1-3-5-13/h1-7,12H,8-11H2 |
| InChIKey | SVBZZRSQUZLCHA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|