C17H16BrNO2 — CID 39097643
3-(2-bromoethyl)-6-[(4-methylphenyl)methoxy]-1,2-benzoxazole (PubChem CID 39097643) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 3-(2-bromoethyl)-6-[(4-methylphenyl)methoxy]-1,2-benzoxazole.
| Compound Name | 3-(2-bromoethyl)-6-[(4-methylphenyl)methoxy]-1,2-benzoxazole |
|---|---|
| PubChem CID | 39097643 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-(2-bromoethyl)-6-[(4-methylphenyl)methoxy]-1,2-benzoxazole |
| SMILES | Cc1ccc(COc2ccc3c(CCBr)noc3c2)cc1 |
| InChI | InChI=1S/C17H16BrNO2/c1-12-2-4-13(5-3-12)11-20-14-6-7-15-16(8-9-18)19-21-17(15)10-14/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | PESPRIJKUPKPLL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|