C17H15BrClNO2 — CID 39097696
3-(2-bromoethyl)-5-chloro-6-[(4-methylphenyl)methoxy]-1,2-benzoxazole (PubChem CID 39097696) has the molecular formula C17H15BrClNO2 and a molecular weight of 380.67 g/mol. Its IUPAC name is 3-(2-bromoethyl)-5-chloro-6-[(4-methylphenyl)methoxy]-1,2-benzoxazole.
| Compound Name | 3-(2-bromoethyl)-5-chloro-6-[(4-methylphenyl)methoxy]-1,2-benzoxazole |
|---|---|
| PubChem CID | 39097696 |
| Molecular Formula | C17H15BrClNO2 |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 3-(2-bromoethyl)-5-chloro-6-[(4-methylphenyl)methoxy]-1,2-benzoxazole |
| SMILES | Cc1ccc(COc2cc3onc(CCBr)c3cc2Cl)cc1 |
| InChI | InChI=1S/C17H15BrClNO2/c1-11-2-4-12(5-3-11)10-21-17-9-16-13(8-14(17)19)15(6-7-18)20-22-16/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | YDTTXEJHEMVVAL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|