C12H14ClNO2S — CID 39097993
2-(5-chloro-6-propoxy-1,2-benzoxazol-3-yl)ethanethiol (PubChem CID 39097993) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is 2-(5-chloro-6-propoxy-1,2-benzoxazol-3-yl)ethanethiol.
| Compound Name | 2-(5-chloro-6-propoxy-1,2-benzoxazol-3-yl)ethanethiol |
|---|---|
| PubChem CID | 39097993 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-(5-chloro-6-propoxy-1,2-benzoxazol-3-yl)ethanethiol |
| SMILES | CCCOc1cc2onc(CCS)c2cc1Cl |
| InChI | InChI=1S/C12H14ClNO2S/c1-2-4-15-12-7-11-8(6-9(12)13)10(3-5-17)14-16-11/h6-7,17H,2-5H2,1H3 |
| InChIKey | QRQUPJZOFKUUTF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|