C9H10Cl2OS — CID 91874244
4,5-dichloro-2-propoxybenzenethiol (PubChem CID 91874244) has the molecular formula C9H10Cl2OS and a molecular weight of 237.15 g/mol. Its IUPAC name is 4,5-dichloro-2-propoxybenzenethiol.
| Compound Name | 4,5-dichloro-2-propoxybenzenethiol |
|---|---|
| PubChem CID | 91874244 |
| Molecular Formula | C9H10Cl2OS |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 4,5-dichloro-2-propoxybenzenethiol |
| SMILES | CCCOc1cc(Cl)c(Cl)cc1S |
| InChI | InChI=1S/C9H10Cl2OS/c1-2-3-12-8-4-6(10)7(11)5-9(8)13/h4-5,13H,2-3H2,1H3 |
| InChIKey | COBQJIVHNJJPAA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|