C14H12N2O3 — CID 71452042
5-[(4-methylphenyl)methoxy]-1-oxido-2,1,3-benzoxadiazol-1-ium (PubChem CID 71452042) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methoxy]-1-oxido-2,1,3-benzoxadiazol-1-ium.
| Compound Name | 5-[(4-methylphenyl)methoxy]-1-oxido-2,1,3-benzoxadiazol-1-ium |
|---|---|
| PubChem CID | 71452042 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-[(4-methylphenyl)methoxy]-1-oxido-2,1,3-benzoxadiazol-1-ium |
| SMILES | Cc1ccc(COc2ccc3c(c2)no[n+]3[O-])cc1 |
| InChI | InChI=1S/C14H12N2O3/c1-10-2-4-11(5-3-10)9-18-12-6-7-14-13(8-12)15-19-16(14)17/h2-8H,9H2,1H3 |
| InChIKey | RQWPTNPKQOHPAS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 62.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|