C11H11Br2NO — CID 39097550
5-bromo-3-(2-bromoethyl)-6,7-dimethyl-1,2-benzoxazole (PubChem CID 39097550) has the molecular formula C11H11Br2NO and a molecular weight of 333.02 g/mol. Its IUPAC name is 5-bromo-3-(2-bromoethyl)-6,7-dimethyl-1,2-benzoxazole.
| Compound Name | 5-bromo-3-(2-bromoethyl)-6,7-dimethyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 39097550 |
| Molecular Formula | C11H11Br2NO |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | 5-bromo-3-(2-bromoethyl)-6,7-dimethyl-1,2-benzoxazole |
| SMILES | Cc1c(Br)cc2c(CCBr)noc2c1C |
| InChI | InChI=1S/C11H11Br2NO/c1-6-7(2)11-8(5-9(6)13)10(3-4-12)14-15-11/h5H,3-4H2,1-2H3 |
| InChIKey | HFHOQTBEBHJVDA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|