C10H11BrN2O — CID 82232643
(5-bromo-6,7-dimethyl-1,3-benzoxazol-2-yl)methanamine (PubChem CID 82232643) has the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. Its IUPAC name is (5-bromo-6,7-dimethyl-1,3-benzoxazol-2-yl)methanamine.
| Compound Name | (5-bromo-6,7-dimethyl-1,3-benzoxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 82232643 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | (5-bromo-6,7-dimethyl-1,3-benzoxazol-2-yl)methanamine |
| SMILES | Cc1c(Br)cc2nc(CN)oc2c1C |
| InChI | InChI=1S/C10H11BrN2O/c1-5-6(2)10-8(3-7(5)11)13-9(4-12)14-10/h3H,4,12H2,1-2H3 |
| InChIKey | SMQPLHZRASZNIG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |