C26H32N4O2 — CID 21366171
5,6,7-trimethyl-2-[[4-[(5,6,7-trimethyl-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]methyl]-1,3-benzoxazole (PubChem CID 21366171) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 5,6,7-trimethyl-2-[[4-[(5,6,7-trimethyl-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]methyl]-1,3-benzoxazole.
| Compound Name | 5,6,7-trimethyl-2-[[4-[(5,6,7-trimethyl-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]methyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 21366171 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 5,6,7-trimethyl-2-[[4-[(5,6,7-trimethyl-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]methyl]-1,3-benzoxazole |
| SMILES | Cc1cc2nc(CN3CCN(Cc4nc5cc(C)c(C)c(C)c5o4)CC3)oc2c(C)c1C |
| InChI | InChI=1S/C26H32N4O2/c1-15-11-21-25(19(5)17(15)3)31-23(27-21)13-29-7-9-30(10-8-29)14-24-28-22-12-16(2)18(4)20(6)26(22)32-24/h11-12H,7-10,13-14H2,1-6H3 |
| InChIKey | FLARXOLCFHFJBL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |