C8H6ClN3O3 — CID 137332751
(5-chloro-7-nitro-1,3-benzoxazol-2-yl)methanamine (PubChem CID 137332751) has the molecular formula C8H6ClN3O3 and a molecular weight of 227.61 g/mol. Its IUPAC name is (5-chloro-7-nitro-1,3-benzoxazol-2-yl)methanamine.
| Compound Name | (5-chloro-7-nitro-1,3-benzoxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 137332751 |
| Molecular Formula | C8H6ClN3O3 |
| Molecular Weight | 227.61 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | (5-chloro-7-nitro-1,3-benzoxazol-2-yl)methanamine |
| SMILES | NCc1nc2cc(Cl)cc([N+](=O)[O-])c2o1 |
| InChI | InChI=1S/C8H6ClN3O3/c9-4-1-5-8(6(2-4)12(13)14)15-7(3-10)11-5/h1-2H,3,10H2 |
| InChIKey | AFHPMPFYXNVTSR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.61 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|