C16H8ClN3O3S — CID 5209791
3-(1,3-benzothiazol-2-yl)-6-chloro-8-nitrochromen-2-imine (PubChem CID 5209791) has the molecular formula C16H8ClN3O3S and a molecular weight of 357.78 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-6-chloro-8-nitrochromen-2-imine.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-6-chloro-8-nitrochromen-2-imine |
|---|---|
| PubChem CID | 5209791 |
| Molecular Formula | C16H8ClN3O3S |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-6-chloro-8-nitrochromen-2-imine |
| SMILES | [H]/N=c1\oc2c([N+](=O)[O-])cc(Cl)cc2cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H8ClN3O3S/c17-9-5-8-6-10(15(18)23-14(8)12(7-9)20(21)22)16-19-11-3-1-2-4-13(11)24-16/h1-7,18H/b18-15- |
| InChIKey | GJPCEBCBEXOPAB-SDXDJHTJSA-N |
| XLogP | 4.75 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|