C23H14ClNO2S — CID 164684256
8-(1,3-benzothiazol-2-yl)-4-(3-chlorophenyl)-3-methylchromen-2-one (PubChem CID 164684256) has the molecular formula C23H14ClNO2S and a molecular weight of 403.89 g/mol. Its IUPAC name is 8-(1,3-benzothiazol-2-yl)-4-(3-chlorophenyl)-3-methylchromen-2-one.
| Compound Name | 8-(1,3-benzothiazol-2-yl)-4-(3-chlorophenyl)-3-methylchromen-2-one |
|---|---|
| PubChem CID | 164684256 |
| Molecular Formula | C23H14ClNO2S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 8-(1,3-benzothiazol-2-yl)-4-(3-chlorophenyl)-3-methylchromen-2-one |
| SMILES | Cc1c(-c2cccc(Cl)c2)c2cccc(-c3nc4ccccc4s3)c2oc1=O |
| InChI | InChI=1S/C23H14ClNO2S/c1-13-20(14-6-4-7-15(24)12-14)16-8-5-9-17(21(16)27-23(13)26)22-25-18-10-2-3-11-19(18)28-22/h2-12H,1H3 |
| InChIKey | PTNZGGXYPZPGBY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|