About 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one
3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one (PubChem CID 3608615) has the molecular formula C16H7Br2NO2S
and a molecular weight of 437.11 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one |
| PubChem CID | 3608615 |
| Molecular Formula | C16H7Br2NO2S |
| Molecular Weight | 437.11 g/mol |
| Exact Mass | 434.86 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one |
| SMILES | O=c1oc2c(Br)cc(Br)cc2cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H7Br2NO2S/c17-9-5-8-6-10(16(20)21-14(8)11(18)7-9)15-19-12-3-1-2-4-13(12)22-15/h1-7H |
| InChIKey | UUWYRKNXQYRCFD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.11 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one?
The IUPAC name of 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one (CID 3608615) is 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one.
What is the SMILES notation for 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one?
The canonical SMILES for 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one is O=c1oc2c(Br)cc(Br)cc2cc1-c1nc2ccccc2s1.
What is the InChIKey of 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one?
The InChIKey is UUWYRKNXQYRCFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H7Br2NO2S/c17-9-5-8-6-10(16(20)21-14(8)11(18)7-9)15-19-12-3-1-2-4-13(12)22-15/h1-7H.
What are the key properties of 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one?
3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one has a molecular weight of 437.11 g/mol, XLogP of 5.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one is sourced from PubChem (CID 3608615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).