C16H7Br2NO2S — CID 3608615
3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one (PubChem CID 3608615) has the molecular formula C16H7Br2NO2S and a molecular weight of 437.11 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one |
|---|---|
| PubChem CID | 3608615 |
| Molecular Formula | C16H7Br2NO2S |
| Molecular Weight | 437.11 g/mol |
| Exact Mass | 434.86 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-6,8-dibromochromen-2-one |
| SMILES | O=c1oc2c(Br)cc(Br)cc2cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H7Br2NO2S/c17-9-5-8-6-10(16(20)21-14(8)11(18)7-9)15-19-12-3-1-2-4-13(12)22-15/h1-7H |
| InChIKey | UUWYRKNXQYRCFD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.11 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|