C24H13Br2NO3S — CID 3123891
6,8-dibromo-3-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]chromen-2-one (PubChem CID 3123891) has the molecular formula C24H13Br2NO3S and a molecular weight of 555.25 g/mol. Its IUPAC name is 6,8-dibromo-3-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]chromen-2-one.
| Compound Name | 6,8-dibromo-3-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 3123891 |
| Molecular Formula | C24H13Br2NO3S |
| Molecular Weight | 555.25 g/mol |
| Exact Mass | 552.90 |
| IUPAC Name | 6,8-dibromo-3-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]chromen-2-one |
| SMILES | O=c1oc2c(Br)cc(Br)cc2cc1-c1nc(-c2ccc(Oc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C24H13Br2NO3S/c25-16-10-15-11-19(24(28)30-22(15)20(26)12-16)23-27-21(13-31-23)14-6-8-18(9-7-14)29-17-4-2-1-3-5-17/h1-13H |
| InChIKey | UWEHWPDCQOASPT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.25 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|