C26H17NO4S — CID 23761668
[3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-oxochromen-7-yl] benzoate (PubChem CID 23761668) has the molecular formula C26H17NO4S and a molecular weight of 439.49 g/mol. Its IUPAC name is [3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-oxochromen-7-yl] benzoate.
| Compound Name | [3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-oxochromen-7-yl] benzoate |
|---|---|
| PubChem CID | 23761668 |
| Molecular Formula | C26H17NO4S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | [3-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-oxochromen-7-yl] benzoate |
| SMILES | Cc1ccc(-c2csc(-c3cc4ccc(OC(=O)c5ccccc5)cc4oc3=O)n2)cc1 |
| InChI | InChI=1S/C26H17NO4S/c1-16-7-9-17(10-8-16)22-15-32-24(27-22)21-13-19-11-12-20(14-23(19)31-26(21)29)30-25(28)18-5-3-2-4-6-18/h2-15H,1H3 |
| InChIKey | YMGZDWFXCCLXEE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|