C31H21Br2N3O4S — CID 11227776
6,8-dibromo-3-[3-[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-phenylimino-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 11227776) has the molecular formula C31H21Br2N3O4S and a molecular weight of 691.40 g/mol. Its IUPAC name is 6,8-dibromo-3-[3-[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-phenylimino-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 6,8-dibromo-3-[3-[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-phenylimino-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 11227776 |
| Molecular Formula | C31H21Br2N3O4S |
| Molecular Weight | 691.40 g/mol |
| Exact Mass | 688.96 |
| IUPAC Name | 6,8-dibromo-3-[3-[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-phenylimino-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | COc1ccc(/C=C/c2onc(C)c2-n2c(-c3cc4cc(Br)cc(Br)c4oc3=O)cs/c2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C31H21Br2N3O4S/c1-18-28(27(40-35-18)13-10-19-8-11-23(38-2)12-9-19)36-26(17-41-31(36)34-22-6-4-3-5-7-22)24-15-20-14-21(32)16-25(33)29(20)39-30(24)37/h3-17H,1-2H3/b13-10+,34-31- |
| InChIKey | NORQGPAMTWYMRE-GRKGKJEDSA-N |
| XLogP | 8.55 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.40 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|