C27H16BrNO5S — CID 3811220
ethyl 8-(1,3-benzothiazol-2-yl)-5-bromo-7-oxo-2-phenylfuro[3,2-f]chromene-1-carboxylate (PubChem CID 3811220) has the molecular formula C27H16BrNO5S and a molecular weight of 546.40 g/mol. Its IUPAC name is ethyl 8-(1,3-benzothiazol-2-yl)-5-bromo-7-oxo-2-phenylfuro[3,2-f]chromene-1-carboxylate.
| Compound Name | ethyl 8-(1,3-benzothiazol-2-yl)-5-bromo-7-oxo-2-phenylfuro[3,2-f]chromene-1-carboxylate |
|---|---|
| PubChem CID | 3811220 |
| Molecular Formula | C27H16BrNO5S |
| Molecular Weight | 546.40 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | ethyl 8-(1,3-benzothiazol-2-yl)-5-bromo-7-oxo-2-phenylfuro[3,2-f]chromene-1-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)oc2cc(Br)c3oc(=O)c(-c4nc5ccccc5s4)cc3c12 |
| InChI | InChI=1S/C27H16BrNO5S/c1-2-32-27(31)22-21-15-12-16(25-29-18-10-6-7-11-20(18)35-25)26(30)34-24(15)17(28)13-19(21)33-23(22)14-8-4-3-5-9-14/h3-13H,2H2,1H3 |
| InChIKey | WQLXWPPRLPXQNI-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.40 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'coumarin_E(1)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|